C20H22N2O3 — CID 58147133
N-hydroxy-2-[2-(4-methylphenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 58147133) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-hydroxy-2-[2-(4-methylphenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | N-hydroxy-2-[2-(4-methylphenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 58147133 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-hydroxy-2-[2-(4-methylphenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | Cc1ccc(C(C)C(=O)N2CCc3cc(C(=O)NO)ccc3C2)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-13-3-5-15(6-4-13)14(2)20(24)22-10-9-16-11-17(19(23)21-25)7-8-18(16)12-22/h3-8,11,14,25H,9-10,12H2,1-2H3,(H,21,23) |
| InChIKey | SILRLTDLSZXOHR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|