C26H31N5O3S — CID 58147707
9-(3-azidopropoxy)-N-tert-butyl-8-methoxy-N-methyl-1-thiophen-2-yl-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide (PubChem CID 58147707) has the molecular formula C26H31N5O3S and a molecular weight of 493.63 g/mol. Its IUPAC name is 9-(3-azidopropoxy)-N-tert-butyl-8-methoxy-N-methyl-1-thiophen-2-yl-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide.
| Compound Name | 9-(3-azidopropoxy)-N-tert-butyl-8-methoxy-N-methyl-1-thiophen-2-yl-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 58147707 |
| Molecular Formula | C26H31N5O3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 9-(3-azidopropoxy)-N-tert-butyl-8-methoxy-N-methyl-1-thiophen-2-yl-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide |
| SMILES | COc1cc2c(cc1OCCCN=[N+]=[N-])-c1c(-c3cccs3)cc(C(=O)N(C)C(C)(C)C)n1CC2 |
| InChI | InChI=1S/C26H31N5O3S/c1-26(2,3)30(4)25(32)20-15-19(23-8-6-13-35-23)24-18-16-22(34-12-7-10-28-29-27)21(33-5)14-17(18)9-11-31(20)24/h6,8,13-16H,7,9-12H2,1-5H3 |
| InChIKey | DXPDTHPMYDASKG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 92.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|