About ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate
ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate (PubChem CID 58147733) has the molecular formula C14H19FO4
and a molecular weight of 270.30 g/mol. Its IUPAC name is ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate.
Molecular Properties
| Compound Name | ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate |
| PubChem CID | 58147733 |
| Molecular Formula | C14H19FO4 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate |
| SMILES | CCOC(=O)CCCc1cc(F)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H19FO4/c1-4-19-13(16)7-5-6-10-8-11(15)14(18-3)12(9-10)17-2/h8-9H,4-7H2,1-3H3 |
| InChIKey | NFLPMCURJFFWFZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate?
The IUPAC name of ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate (CID 58147733) is ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate.
What is the SMILES notation for ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate?
The canonical SMILES for ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate is CCOC(=O)CCCc1cc(F)c(OC)c(OC)c1.
What is the InChIKey of ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate?
The InChIKey is NFLPMCURJFFWFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FO4/c1-4-19-13(16)7-5-6-10-8-11(15)14(18-3)12(9-10)17-2/h8-9H,4-7H2,1-3H3.
What are the key properties of ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate?
ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate has a molecular weight of 270.30 g/mol, XLogP of 2.73, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3-fluoro-4,5-dimethoxyphenyl)butanoate is sourced from PubChem (CID 58147733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).