C10H9N2Y- — CID 58148024
2-methyl-4-methylidene-3H-pyrido[1,2-a]pyrimidin-3-ide;yttrium (PubChem CID 58148024) has the molecular formula C10H9N2Y- and a molecular weight of 246.10 g/mol. Its IUPAC name is 2-methyl-4-methylidene-3H-pyrido[1,2-a]pyrimidin-3-ide;yttrium.
| Compound Name | 2-methyl-4-methylidene-3H-pyrido[1,2-a]pyrimidin-3-ide;yttrium |
|---|---|
| PubChem CID | 58148024 |
| Molecular Formula | C10H9N2Y- |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 2-methyl-4-methylidene-3H-pyrido[1,2-a]pyrimidin-3-ide;yttrium |
| SMILES | C=C1[C-]=C(C)N=C2C=CC=CN12.[Y] |
| InChI | InChI=1S/C10H9N2.Y/c1-8-7-9(2)12-6-4-3-5-10(12)11-8;/h3-6H,2H2,1H3;/q-1; |
| InChIKey | ALYWPMCLDXZFEU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|