C10H10N2 — CID 58148025
2-methyl-4-methylidenepyrido[1,2-a]pyrimidine (PubChem CID 58148025) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-methyl-4-methylidenepyrido[1,2-a]pyrimidine.
| Compound Name | 2-methyl-4-methylidenepyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 58148025 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 2-methyl-4-methylidenepyrido[1,2-a]pyrimidine |
| SMILES | C=C1C=C(C)N=C2C=CC=CN12 |
| InChI | InChI=1S/C10H10N2/c1-8-7-9(2)12-6-4-3-5-10(12)11-8/h3-7H,2H2,1H3 |
| InChIKey | LFGNSUWOYTWSLC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |