About 6-(2,2-dimethylpropyl)-2,3-difluorophenol
6-(2,2-dimethylpropyl)-2,3-difluorophenol (PubChem CID 58149383) has the molecular formula C11H14F2O
and a molecular weight of 200.23 g/mol. Its IUPAC name is 6-(2,2-dimethylpropyl)-2,3-difluorophenol.
Molecular Properties
| Compound Name | 6-(2,2-dimethylpropyl)-2,3-difluorophenol |
| PubChem CID | 58149383 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 6-(2,2-dimethylpropyl)-2,3-difluorophenol |
| SMILES | CC(C)(C)Cc1ccc(F)c(F)c1O |
| InChI | InChI=1S/C11H14F2O/c1-11(2,3)6-7-4-5-8(12)9(13)10(7)14/h4-5,14H,6H2,1-3H3 |
| InChIKey | OBYVHTXYTHSHKG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(2,2-dimethylpropyl)-2,3-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-dimethylpropyl)-2,3-difluorophenol?
The IUPAC name of 6-(2,2-dimethylpropyl)-2,3-difluorophenol (CID 58149383) is 6-(2,2-dimethylpropyl)-2,3-difluorophenol.
What is the SMILES notation for 6-(2,2-dimethylpropyl)-2,3-difluorophenol?
The canonical SMILES for 6-(2,2-dimethylpropyl)-2,3-difluorophenol is CC(C)(C)Cc1ccc(F)c(F)c1O.
What is the InChIKey of 6-(2,2-dimethylpropyl)-2,3-difluorophenol?
The InChIKey is OBYVHTXYTHSHKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O/c1-11(2,3)6-7-4-5-8(12)9(13)10(7)14/h4-5,14H,6H2,1-3H3.
What are the key properties of 6-(2,2-dimethylpropyl)-2,3-difluorophenol?
6-(2,2-dimethylpropyl)-2,3-difluorophenol has a molecular weight of 200.23 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-dimethylpropyl)-2,3-difluorophenol is sourced from PubChem (CID 58149383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).