C14H25NO6 — CID 58149465
tert-butyl (3aS,6S,6aR)-6-(hydroxymethyl)-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate (PubChem CID 58149465) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl (3aS,6S,6aR)-6-(hydroxymethyl)-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3aS,6S,6aR)-6-(hydroxymethyl)-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 58149465 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | tert-butyl (3aS,6S,6aR)-6-(hydroxymethyl)-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate |
| SMILES | COC1(OC)CO[C@@H]2[C@H](CO)CN(C(=O)OC(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C14H25NO6/c1-13(2,3)21-12(17)15-6-9(7-16)10-11(15)14(18-4,19-5)8-20-10/h9-11,16H,6-8H2,1-5H3/t9-,10+,11-/m0/s1 |
| InChIKey | BBVPUOADGFDCHY-AXFHLTTASA-N |
| XLogP | 0.60 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|