C16H26N2O4 — CID 58149473
(2S)-1-[(3aS,6R,6aR)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-2-amino-4-methylpentan-1-one (PubChem CID 58149473) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2S)-1-[(3aS,6R,6aR)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-2-amino-4-methylpentan-1-one.
| Compound Name | (2S)-1-[(3aS,6R,6aR)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-2-amino-4-methylpentan-1-one |
|---|---|
| PubChem CID | 58149473 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (2S)-1-[(3aS,6R,6aR)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-2-amino-4-methylpentan-1-one |
| SMILES | C#C[C@@H]1CN(C(=O)[C@@H](N)CC(C)C)[C@H]2[C@@H]1OCC2(OC)OC |
| InChI | InChI=1S/C16H26N2O4/c1-6-11-8-18(15(19)12(17)7-10(2)3)14-13(11)22-9-16(14,20-4)21-5/h1,10-14H,7-9,17H2,2-5H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | LUGPWHAVFQLSSY-RQJABVFESA-N |
| XLogP | 0.21 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|