C35H44N6O5 — CID 58149566
tert-butyl (2S)-4-(1,3-benzodioxol-5-yl)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxobutanoate (PubChem CID 58149566) has the molecular formula C35H44N6O5 and a molecular weight of 628.77 g/mol. Its IUPAC name is tert-butyl (2S)-4-(1,3-benzodioxol-5-yl)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxobutanoate.
| Compound Name | tert-butyl (2S)-4-(1,3-benzodioxol-5-yl)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 58149566 |
| Molecular Formula | C35H44N6O5 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | tert-butyl (2S)-4-(1,3-benzodioxol-5-yl)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxobutanoate |
| SMILES | CCc1c(NC[C@H](CC(=O)c2ccc3c(c2)OCO3)C(=O)OC(C)(C)C)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C35H44N6O5/c1-5-26-32(37-19-25(34(43)46-35(2,3)4)17-28(42)24-9-11-29-30(18-24)45-21-44-29)38-20-39-33(26)41-15-12-22(13-16-41)27-10-8-23-7-6-14-36-31(23)40-27/h8-11,18,20,22,25H,5-7,12-17,19,21H2,1-4H3,(H,36,40)(H,37,38,39)/t25-/m0/s1 |
| InChIKey | DXOGREYFNLRELE-VWLOTQADSA-N |
| XLogP | 5.55 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |