C34H44FN7O3 — CID 58149590
tert-butyl (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-(3-fluoroanilino)-4-oxobutanoate (PubChem CID 58149590) has the molecular formula C34H44FN7O3 and a molecular weight of 617.77 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-(3-fluoroanilino)-4-oxobutanoate.
| Compound Name | tert-butyl (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-(3-fluoroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 58149590 |
| Molecular Formula | C34H44FN7O3 |
| Molecular Weight | 617.77 g/mol |
| Exact Mass | 617.35 |
| IUPAC Name | tert-butyl (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-(3-fluoroanilino)-4-oxobutanoate |
| SMILES | CCc1c(NC[C@H](CC(=O)Nc2cccc(F)c2)C(=O)OC(C)(C)C)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C34H44FN7O3/c1-5-27-31(37-20-24(33(44)45-34(2,3)4)18-29(43)40-26-10-6-9-25(35)19-26)38-21-39-32(27)42-16-13-22(14-17-42)28-12-11-23-8-7-15-36-30(23)41-28/h6,9-12,19,21-22,24H,5,7-8,13-18,20H2,1-4H3,(H,36,41)(H,40,43)(H,37,38,39)/t24-/m0/s1 |
| InChIKey | MTGZPJGPVIGGQX-DEOSSOPVSA-N |
| XLogP | 5.71 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.77 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |