C36H49N7O5 — CID 58149594
tert-butyl (2S)-4-(3,4-dimethoxyanilino)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxobutanoate (PubChem CID 58149594) has the molecular formula C36H49N7O5 and a molecular weight of 659.83 g/mol. Its IUPAC name is tert-butyl (2S)-4-(3,4-dimethoxyanilino)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxobutanoate.
| Compound Name | tert-butyl (2S)-4-(3,4-dimethoxyanilino)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 58149594 |
| Molecular Formula | C36H49N7O5 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.38 |
| IUPAC Name | tert-butyl (2S)-4-(3,4-dimethoxyanilino)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxobutanoate |
| SMILES | CCc1c(NC[C@H](CC(=O)Nc2ccc(OC)c(OC)c2)C(=O)OC(C)(C)C)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C36H49N7O5/c1-7-27-33(39-22-40-34(27)43-17-14-23(15-18-43)28-12-10-24-9-8-16-37-32(24)42-28)38-21-25(35(45)48-36(2,3)4)19-31(44)41-26-11-13-29(46-5)30(20-26)47-6/h10-13,20,22-23,25H,7-9,14-19,21H2,1-6H3,(H,37,42)(H,41,44)(H,38,39,40)/t25-/m0/s1 |
| InChIKey | KCCGYTWYFWLBJR-VWLOTQADSA-N |
| XLogP | 5.59 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |