About 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine
4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine (PubChem CID 581496) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine |
| PubChem CID | 581496 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine |
| SMILES | CCCC1CC(c2csc(N)n2)CCO1 |
| InChI | InChI=1S/C11H18N2OS/c1-2-3-9-6-8(4-5-14-9)10-7-15-11(12)13-10/h7-9H,2-6H2,1H3,(H2,12,13) |
| InChIKey | SIINGJBLYGBGDL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine (CID 581496) is 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine is CCCC1CC(c2csc(N)n2)CCO1.
What is the InChIKey of 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine?
The InChIKey is SIINGJBLYGBGDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-2-3-9-6-8(4-5-14-9)10-7-15-11(12)13-10/h7-9H,2-6H2,1H3,(H2,12,13).
What are the key properties of 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine?
4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine has a molecular weight of 226.34 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-propyloxan-4-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 581496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).