C16H16N4O2S2 — CID 58149661
5-(benzenesulfonyl)-4-methylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene (PubChem CID 58149661) has the molecular formula C16H16N4O2S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-4-methylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene.
| Compound Name | 5-(benzenesulfonyl)-4-methylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
|---|---|
| PubChem CID | 58149661 |
| Molecular Formula | C16H16N4O2S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 5-(benzenesulfonyl)-4-methylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
| SMILES | CSc1nn2c3c(cnc2c1S(=O)(=O)c1ccccc1)CNCC3 |
| InChI | InChI=1S/C16H16N4O2S2/c1-23-16-14(24(21,22)12-5-3-2-4-6-12)15-18-10-11-9-17-8-7-13(11)20(15)19-16/h2-6,10,17H,7-9H2,1H3 |
| InChIKey | HTRMQKBEVZSAJS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |