C17H17FN4O2S2 — CID 58149672
5-(4-fluorophenyl)sulfonyl-11-methyl-4-methylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene (PubChem CID 58149672) has the molecular formula C17H17FN4O2S2 and a molecular weight of 392.48 g/mol. Its IUPAC name is 5-(4-fluorophenyl)sulfonyl-11-methyl-4-methylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene.
| Compound Name | 5-(4-fluorophenyl)sulfonyl-11-methyl-4-methylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
|---|---|
| PubChem CID | 58149672 |
| Molecular Formula | C17H17FN4O2S2 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 5-(4-fluorophenyl)sulfonyl-11-methyl-4-methylsulfanyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
| SMILES | CSc1nn2c3c(cnc2c1S(=O)(=O)c1ccc(F)cc1)CN(C)CC3 |
| InChI | InChI=1S/C17H17FN4O2S2/c1-21-8-7-14-11(10-21)9-19-16-15(17(25-2)20-22(14)16)26(23,24)13-5-3-12(18)4-6-13/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | PBXPMWAJYADUNN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |