About ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate
ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate (PubChem CID 58149896) has the molecular formula C16H19N3O3
and a molecular weight of 301.35 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate |
| PubChem CID | 58149896 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCc1nccc2c(/C(N)=N/O)cccc12 |
| InChI | InChI=1S/C16H19N3O3/c1-2-22-15(20)8-4-7-14-12-5-3-6-13(16(17)19-21)11(12)9-10-18-14/h3,5-6,9-10,21H,2,4,7-8H2,1H3,(H2,17,19) |
| InChIKey | GEGXQAHLYVARMR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate?
The IUPAC name of ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate (CID 58149896) is ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate.
What is the SMILES notation for ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate?
The canonical SMILES for ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate is CCOC(=O)CCCc1nccc2c(/C(N)=N/O)cccc12.
What is the InChIKey of ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate?
The InChIKey is GEGXQAHLYVARMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3/c1-2-22-15(20)8-4-7-14-12-5-3-6-13(16(17)19-21)11(12)9-10-18-14/h3,5-6,9-10,21H,2,4,7-8H2,1H3,(H2,17,19).
What are the key properties of ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate?
ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate has a molecular weight of 301.35 g/mol, XLogP of 2.22, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]isoquinolin-1-yl]butanoate is sourced from PubChem (CID 58149896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).