C34H50F5NO6 — CID 58150304
5-O-butyl 1-O-(2,2,3,3,3-pentafluoropropyl) 2-(2,6-diethyl-2,3,6-trimethyl-4-oxopiperidin-1-yl)oxy-2-methyl-4-(2-phenylpropyl)pentanedioate (PubChem CID 58150304) has the molecular formula C34H50F5NO6 and a molecular weight of 663.77 g/mol. Its IUPAC name is 5-O-butyl 1-O-(2,2,3,3,3-pentafluoropropyl) 2-(2,6-diethyl-2,3,6-trimethyl-4-oxopiperidin-1-yl)oxy-2-methyl-4-(2-phenylpropyl)pentanedioate.
| Compound Name | 5-O-butyl 1-O-(2,2,3,3,3-pentafluoropropyl) 2-(2,6-diethyl-2,3,6-trimethyl-4-oxopiperidin-1-yl)oxy-2-methyl-4-(2-phenylpropyl)pentanedioate |
|---|---|
| PubChem CID | 58150304 |
| Molecular Formula | C34H50F5NO6 |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.36 |
| IUPAC Name | 5-O-butyl 1-O-(2,2,3,3,3-pentafluoropropyl) 2-(2,6-diethyl-2,3,6-trimethyl-4-oxopiperidin-1-yl)oxy-2-methyl-4-(2-phenylpropyl)pentanedioate |
| SMILES | CCCCOC(=O)C(CC(C)c1ccccc1)CC(C)(ON1C(C)(CC)CC(=O)C(C)C1(C)CC)C(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H50F5NO6/c1-9-12-18-44-28(42)26(19-23(4)25-16-14-13-15-17-25)20-32(8,29(43)45-22-33(35,36)34(37,38)39)46-40-30(6,10-2)21-27(41)24(5)31(40,7)11-3/h13-17,23-24,26H,9-12,18-22H2,1-8H3 |
| InChIKey | PDGNMQOGZHEOMQ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|