C15H23F3O7 — CID 58150308
4-O-butyl 1-O-(2,2,2-trifluoroethyl) 3-(1-carboxyoxyethyl)-2,2-dimethylbutanedioate (PubChem CID 58150308) has the molecular formula C15H23F3O7 and a molecular weight of 372.34 g/mol. Its IUPAC name is 4-O-butyl 1-O-(2,2,2-trifluoroethyl) 3-(1-carboxyoxyethyl)-2,2-dimethylbutanedioate.
| Compound Name | 4-O-butyl 1-O-(2,2,2-trifluoroethyl) 3-(1-carboxyoxyethyl)-2,2-dimethylbutanedioate |
|---|---|
| PubChem CID | 58150308 |
| Molecular Formula | C15H23F3O7 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-O-butyl 1-O-(2,2,2-trifluoroethyl) 3-(1-carboxyoxyethyl)-2,2-dimethylbutanedioate |
| SMILES | CCCCOC(=O)C(C(C)OC(=O)O)C(C)(C)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C15H23F3O7/c1-5-6-7-23-11(19)10(9(2)25-13(21)22)14(3,4)12(20)24-8-15(16,17)18/h9-10H,5-8H2,1-4H3,(H,21,22) |
| InChIKey | AUQNONZCUYQJPB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|