C10H12O3 — CID 58150492
1,3,4,6-tetramethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 58150492) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 1,3,4,6-tetramethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | 1,3,4,6-tetramethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 58150492 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1,3,4,6-tetramethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | CC1=C(C)C(=O)C2(C)OC2(C)C1=O |
| InChI | InChI=1S/C10H12O3/c1-5-6(2)8(12)10(4)9(3,13-10)7(5)11/h1-4H3 |
| InChIKey | ZJFPZEVVLWUSQU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|