C23H25F3O3 — CID 58150570
2-[4-(cyclopropylmethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid (PubChem CID 58150570) has the molecular formula C23H25F3O3 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-[4-(cyclopropylmethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid.
| Compound Name | 2-[4-(cyclopropylmethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 58150570 |
| Molecular Formula | C23H25F3O3 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[4-(cyclopropylmethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1ccc(OCC2CC2)c(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C23H25F3O3/c1-14(2)11-20(22(27)28)17-7-10-21(29-13-15-3-4-15)19(12-17)16-5-8-18(9-6-16)23(24,25)26/h5-10,12,14-15,20H,3-4,11,13H2,1-2H3,(H,27,28) |
| InChIKey | KFCPNHDJLPISTI-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |