C20H40Si — CID 58150598
dimethyl-[(2R,3R)-2,3,4,5-tetramethylcyclopentyl]-[(2R,4R,5R)-2,3,4,5-tetramethylcyclopentyl]silane (PubChem CID 58150598) has the molecular formula C20H40Si and a molecular weight of 308.63 g/mol. Its IUPAC name is dimethyl-[(2R,3R)-2,3,4,5-tetramethylcyclopentyl]-[(2R,4R,5R)-2,3,4,5-tetramethylcyclopentyl]silane.
| Compound Name | dimethyl-[(2R,3R)-2,3,4,5-tetramethylcyclopentyl]-[(2R,4R,5R)-2,3,4,5-tetramethylcyclopentyl]silane |
|---|---|
| PubChem CID | 58150598 |
| Molecular Formula | C20H40Si |
| Molecular Weight | 308.63 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | dimethyl-[(2R,3R)-2,3,4,5-tetramethylcyclopentyl]-[(2R,4R,5R)-2,3,4,5-tetramethylcyclopentyl]silane |
| SMILES | CC1C(C)[C@@H](C)[C@@H](C)C1[Si](C)(C)C1[C@H](C)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C20H40Si/c1-11-12(2)16(6)19(15(11)5)21(9,10)20-17(7)13(3)14(4)18(20)8/h11-20H,1-10H3/t11-,12?,13-,14?,15-,16-,17-,18?,19?,20?/m1/s1 |
| InChIKey | SRXWULQRZFUOJF-MWJPOXLSSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|