About pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane
pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane (PubChem CID 58150618) has the molecular formula C6H3F5S2
and a molecular weight of 234.21 g/mol. Its IUPAC name is pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane.
Molecular Properties
| Compound Name | pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane |
| PubChem CID | 58150618 |
| Molecular Formula | C6H3F5S2 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 233.96 |
| IUPAC Name | pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane |
| SMILES | FS(F)(F)(F)(F)C#Cc1ccsc1 |
| InChI | InChI=1S/C6H3F5S2/c7-13(8,9,10,11)4-2-6-1-3-12-5-6/h1,3,5H |
| InChIKey | WQBJGUDDIIFDQA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane?
The IUPAC name of pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane (CID 58150618) is pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane.
What is the SMILES notation for pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane?
The canonical SMILES for pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane is FS(F)(F)(F)(F)C#Cc1ccsc1.
What is the InChIKey of pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane?
The InChIKey is WQBJGUDDIIFDQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F5S2/c7-13(8,9,10,11)4-2-6-1-3-12-5-6/h1,3,5H.
What are the key properties of pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane?
pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane has a molecular weight of 234.21 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentafluoro(2-thiophen-3-ylethynyl)-λ6-sulfane is sourced from PubChem (CID 58150618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).