About potassium;methanesulfinate;hydroxide
potassium;methanesulfinate;hydroxide (PubChem CID 58150651) has the molecular formula CH4KO3S-
and a molecular weight of 135.20 g/mol. Its IUPAC name is potassium;methanesulfinate;hydroxide.
Molecular Properties
| Compound Name | potassium;methanesulfinate;hydroxide |
| PubChem CID | 58150651 |
| Molecular Formula | CH4KO3S- |
| Molecular Weight | 135.20 g/mol |
| Exact Mass | 134.95 |
| IUPAC Name | potassium;methanesulfinate;hydroxide |
| SMILES | CS(=O)[O-].[K+].[OH-] |
| InChI | InChI=1S/CH4O2S.K.H2O/c1-4(2)3;;/h1H3,(H,2,3);;1H2/q;+1;/p-2 |
| InChIKey | CEONXSINFAJXCD-UHFFFAOYSA-L |
| XLogP | -3.68 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.20 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze potassium;methanesulfinate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;methanesulfinate;hydroxide?
The IUPAC name of potassium;methanesulfinate;hydroxide (CID 58150651) is potassium;methanesulfinate;hydroxide.
What is the SMILES notation for potassium;methanesulfinate;hydroxide?
The canonical SMILES for potassium;methanesulfinate;hydroxide is CS(=O)[O-].[K+].[OH-].
What is the InChIKey of potassium;methanesulfinate;hydroxide?
The InChIKey is CEONXSINFAJXCD-UHFFFAOYSA-L. The full InChI is InChI=1S/CH4O2S.K.H2O/c1-4(2)3;;/h1H3,(H,2,3);;1H2/q;+1;/p-2.
What are the key properties of potassium;methanesulfinate;hydroxide?
potassium;methanesulfinate;hydroxide has a molecular weight of 135.20 g/mol, XLogP of -3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;methanesulfinate;hydroxide is sourced from PubChem (CID 58150651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).