C46H57N3O2 — CID 58150821
4-[[4-[4-[(4-anilinophenyl)methyl]anilino]-N-(4-methylpentan-2-yl)anilino]methyl]-2,6-ditert-butylbenzene-1,3-diol (PubChem CID 58150821) has the molecular formula C46H57N3O2 and a molecular weight of 683.98 g/mol. Its IUPAC name is 4-[[4-[4-[(4-anilinophenyl)methyl]anilino]-N-(4-methylpentan-2-yl)anilino]methyl]-2,6-ditert-butylbenzene-1,3-diol.
| Compound Name | 4-[[4-[4-[(4-anilinophenyl)methyl]anilino]-N-(4-methylpentan-2-yl)anilino]methyl]-2,6-ditert-butylbenzene-1,3-diol |
|---|---|
| PubChem CID | 58150821 |
| Molecular Formula | C46H57N3O2 |
| Molecular Weight | 683.98 g/mol |
| Exact Mass | 683.45 |
| IUPAC Name | 4-[[4-[4-[(4-anilinophenyl)methyl]anilino]-N-(4-methylpentan-2-yl)anilino]methyl]-2,6-ditert-butylbenzene-1,3-diol |
| SMILES | CC(C)CC(C)N(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1O)c1ccc(Nc2ccc(Cc3ccc(Nc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H57N3O2/c1-31(2)27-32(3)49(30-35-29-41(45(4,5)6)44(51)42(43(35)50)46(7,8)9)40-25-23-39(24-26-40)48-38-21-17-34(18-22-38)28-33-15-19-37(20-16-33)47-36-13-11-10-12-14-36/h10-26,29,31-32,47-48,50-51H,27-28,30H2,1-9H3 |
| InChIKey | BVSBYVTWIJIVFD-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.98 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|