C16H9FN2O4 — CID 58151062
2-fluoro-6,13-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone (PubChem CID 58151062) has the molecular formula C16H9FN2O4 and a molecular weight of 312.26 g/mol. Its IUPAC name is 2-fluoro-6,13-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone.
| Compound Name | 2-fluoro-6,13-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 58151062 |
| Molecular Formula | C16H9FN2O4 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-fluoro-6,13-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
| SMILES | CN1C(=O)c2ccc3c4c(c(F)cc(c24)C1=O)C(=O)N(C)C3=O |
| InChI | InChI=1S/C16H9FN2O4/c1-18-13(20)6-3-4-7-11-10(6)8(15(18)22)5-9(17)12(11)16(23)19(2)14(7)21/h3-5H,1-2H3 |
| InChIKey | YOHRFHXYDIQFKD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|