C36H20N2O4 — CID 58151073
16-methyl-5-(2-methyl-1,3-dioxobenzo[de]isoquinolin-6-yl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione (PubChem CID 58151073) has the molecular formula C36H20N2O4 and a molecular weight of 544.57 g/mol. Its IUPAC name is 16-methyl-5-(2-methyl-1,3-dioxobenzo[de]isoquinolin-6-yl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione.
| Compound Name | 16-methyl-5-(2-methyl-1,3-dioxobenzo[de]isoquinolin-6-yl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
|---|---|
| PubChem CID | 58151073 |
| Molecular Formula | C36H20N2O4 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 16-methyl-5-(2-methyl-1,3-dioxobenzo[de]isoquinolin-6-yl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
| SMILES | CN1C(=O)c2cccc3c(-c4ccc5c6ccc7c8c(ccc(c9cccc4c95)c86)C(=O)N(C)C7=O)ccc(c23)C1=O |
| InChI | InChI=1S/C36H20N2O4/c1-37-33(39)25-8-4-6-20-18(10-14-26(30(20)25)34(37)40)17-9-11-22-24-13-16-28-32-27(35(41)38(2)36(28)42)15-12-23(31(24)32)21-7-3-5-19(17)29(21)22/h3-16H,1-2H3 |
| InChIKey | CUUKPGOWKIVDJT-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|