C41H60F6O6 — CID 58151132
1-O-[3-(3-hydroxypropyl)-1-adamantyl] 7-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2,2,6-trimethyl-6-(4-phenylhexyl)heptanedioate (PubChem CID 58151132) has the molecular formula C41H60F6O6 and a molecular weight of 762.91 g/mol. Its IUPAC name is 1-O-[3-(3-hydroxypropyl)-1-adamantyl] 7-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2,2,6-trimethyl-6-(4-phenylhexyl)heptanedioate.
| Compound Name | 1-O-[3-(3-hydroxypropyl)-1-adamantyl] 7-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2,2,6-trimethyl-6-(4-phenylhexyl)heptanedioate |
|---|---|
| PubChem CID | 58151132 |
| Molecular Formula | C41H60F6O6 |
| Molecular Weight | 762.91 g/mol |
| Exact Mass | 762.43 |
| IUPAC Name | 1-O-[3-(3-hydroxypropyl)-1-adamantyl] 7-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2,2,6-trimethyl-6-(4-phenylhexyl)heptanedioate |
| SMILES | CCC(CCCC(C)(CCCC(C)(C)C(=O)OC12CC3CC(CC(CCCO)(C3)C1)C2)C(=O)OC(C)CC(O)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C41H60F6O6/c1-6-31(32-13-8-7-9-14-32)15-10-17-36(5,34(50)52-28(2)22-39(51,40(42,43)44)41(45,46)47)18-11-16-35(3,4)33(49)53-38-25-29-21-30(26-38)24-37(23-29,27-38)19-12-20-48/h7-9,13-14,28-31,48,51H,6,10-12,15-27H2,1-5H3 |
| InChIKey | XWUZBYYHSCUZDE-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.91 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |