About 2-fluoro-1,3,4-trimethylcyclohexene
2-fluoro-1,3,4-trimethylcyclohexene (PubChem CID 58151897) has the molecular formula C9H15F
and a molecular weight of 142.22 g/mol. Its IUPAC name is 2-fluoro-1,3,4-trimethylcyclohexene.
Molecular Properties
| Compound Name | 2-fluoro-1,3,4-trimethylcyclohexene |
| PubChem CID | 58151897 |
| Molecular Formula | C9H15F |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 2-fluoro-1,3,4-trimethylcyclohexene |
| SMILES | CC1=C(F)C(C)C(C)CC1 |
| InChI | InChI=1S/C9H15F/c1-6-4-5-7(2)9(10)8(6)3/h6,8H,4-5H2,1-3H3 |
| InChIKey | NYHZWXQRQVQONT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-fluoro-1,3,4-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,3,4-trimethylcyclohexene?
The IUPAC name of 2-fluoro-1,3,4-trimethylcyclohexene (CID 58151897) is 2-fluoro-1,3,4-trimethylcyclohexene.
What is the SMILES notation for 2-fluoro-1,3,4-trimethylcyclohexene?
The canonical SMILES for 2-fluoro-1,3,4-trimethylcyclohexene is CC1=C(F)C(C)C(C)CC1.
What is the InChIKey of 2-fluoro-1,3,4-trimethylcyclohexene?
The InChIKey is NYHZWXQRQVQONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F/c1-6-4-5-7(2)9(10)8(6)3/h6,8H,4-5H2,1-3H3.
What are the key properties of 2-fluoro-1,3,4-trimethylcyclohexene?
2-fluoro-1,3,4-trimethylcyclohexene has a molecular weight of 142.22 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,3,4-trimethylcyclohexene is sourced from PubChem (CID 58151897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).