About 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol
3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol (PubChem CID 58152070) has the molecular formula C6H16N2O6S
and a molecular weight of 244.27 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol |
| PubChem CID | 58152070 |
| Molecular Formula | C6H16N2O6S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol |
| SMILES | O=S(=O)(NCC(O)CO)NCC(O)CO |
| InChI | InChI=1S/C6H16N2O6S/c9-3-5(11)1-7-15(13,14)8-2-6(12)4-10/h5-12H,1-4H2 |
| InChIKey | VIJXNGCXGSIPCJ-UHFFFAOYSA-N |
| XLogP | -3.88 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol?
The IUPAC name of 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol (CID 58152070) is 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol.
What is the SMILES notation for 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol?
The canonical SMILES for 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol is O=S(=O)(NCC(O)CO)NCC(O)CO.
What is the InChIKey of 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol?
The InChIKey is VIJXNGCXGSIPCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O6S/c9-3-5(11)1-7-15(13,14)8-2-6(12)4-10/h5-12H,1-4H2.
What are the key properties of 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol?
3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol has a molecular weight of 244.27 g/mol, XLogP of -3.88, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroxypropylsulfamoylamino)propane-1,2-diol is sourced from PubChem (CID 58152070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).