C24H26N2O3S — CID 58152218
[3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl pentanoate (PubChem CID 58152218) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is [3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl pentanoate.
| Compound Name | [3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl pentanoate |
|---|---|
| PubChem CID | 58152218 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [3-cyano-2-[(E)-2-oxo-4-pyridin-3-ylbut-3-enyl]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OCC1CCc2c(sc(CC(=O)/C=C/c3cccnc3)c2C#N)C1 |
| InChI | InChI=1S/C24H26N2O3S/c1-2-3-6-24(28)29-16-18-8-10-20-21(14-25)23(30-22(20)12-18)13-19(27)9-7-17-5-4-11-26-15-17/h4-5,7,9,11,15,18H,2-3,6,8,10,12-13,16H2,1H3/b9-7+ |
| InChIKey | LEEQGNYUPTYLQN-VQHVLOKHSA-N |
| XLogP | 4.68 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|