C24H23N5O4S — CID 58152258
[3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(3-methyl-1,2-oxazol-4-yl)methyl]carbamate (PubChem CID 58152258) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is [3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(3-methyl-1,2-oxazol-4-yl)methyl]carbamate.
| Compound Name | [3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(3-methyl-1,2-oxazol-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 58152258 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | [3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-[(3-methyl-1,2-oxazol-4-yl)methyl]carbamate |
| SMILES | Cc1nocc1CNC(=O)OCC1CCc2c(sc(NC(=O)/C=C/c3cccnc3)c2C#N)C1 |
| InChI | InChI=1S/C24H23N5O4S/c1-15-18(14-33-29-15)12-27-24(31)32-13-17-4-6-19-20(10-25)23(34-21(19)9-17)28-22(30)7-5-16-3-2-8-26-11-16/h2-3,5,7-8,11,14,17H,4,6,9,12-13H2,1H3,(H,27,31)(H,28,30)/b7-5+ |
| InChIKey | KUAWGXYGWRPRSC-FNORWQNLSA-N |
| XLogP | 3.99 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|