3-(2,5-difluorophenyl)propanoic acid

C9H8F2O2 — CID 581523

IUPAC3-(2,5-difluorophenyl)propanoic acid
SMILESO=C(O)CCc1cc(F)ccc1F
InChIInChI=1S/C9H8F2O2/c10-7-2-3-8(11)6(5-7)1-4-9(12)13/h2-3,5H,1,4H2,(H,12,13)
InChIKeyDURXQDAFKSWAES-UHFFFAOYSA-N
MW186.16 g/mol
LogP1.98
Rot. Bonds3

About 3-(2,5-difluorophenyl)propanoic acid

3-(2,5-difluorophenyl)propanoic acid (PubChem CID 581523) has the molecular formula C9H8F2O2 and a molecular weight of 186.16 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)propanoic acid.

Molecular Properties

Compound Name3-(2,5-difluorophenyl)propanoic acid
PubChem CID581523
Molecular FormulaC9H8F2O2
Molecular Weight186.16 g/mol
Exact Mass186.05
IUPAC Name3-(2,5-difluorophenyl)propanoic acid
SMILESO=C(O)CCc1cc(F)ccc1F
InChIInChI=1S/C9H8F2O2/c10-7-2-3-8(11)6(5-7)1-4-9(12)13/h2-3,5H,1,4H2,(H,12,13)
InChIKeyDURXQDAFKSWAES-UHFFFAOYSA-N
XLogP1.98
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.16
LogP ≤ 51.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-(2,5-difluorophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-difluorophenyl)propanoic acid?
The IUPAC name of 3-(2,5-difluorophenyl)propanoic acid (CID 581523) is 3-(2,5-difluorophenyl)propanoic acid.
What is the SMILES notation for 3-(2,5-difluorophenyl)propanoic acid?
The canonical SMILES for 3-(2,5-difluorophenyl)propanoic acid is O=C(O)CCc1cc(F)ccc1F.
What is the InChIKey of 3-(2,5-difluorophenyl)propanoic acid?
The InChIKey is DURXQDAFKSWAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O2/c10-7-2-3-8(11)6(5-7)1-4-9(12)13/h2-3,5H,1,4H2,(H,12,13).
What are the key properties of 3-(2,5-difluorophenyl)propanoic acid?
3-(2,5-difluorophenyl)propanoic acid has a molecular weight of 186.16 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-difluorophenyl)propanoic acid is sourced from PubChem (CID 581523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).