C11H11N2O2RbS — CID 58152430
6-(hydroxymethyl)-2-(oxomethylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;rubidium(1+) (PubChem CID 58152430) has the molecular formula C11H11N2O2RbS and a molecular weight of 320.76 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2-(oxomethylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;rubidium(1+).
| Compound Name | 6-(hydroxymethyl)-2-(oxomethylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;rubidium(1+) |
|---|---|
| PubChem CID | 58152430 |
| Molecular Formula | C11H11N2O2RbS |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 6-(hydroxymethyl)-2-(oxomethylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;rubidium(1+) |
| SMILES | N#Cc1c(N[C-]=O)sc2c1CCC(CO)C2.[Rb+] |
| InChI | InChI=1S/C11H11N2O2S.Rb/c12-4-9-8-2-1-7(5-14)3-10(8)16-11(9)13-6-15;/h7,14H,1-3,5H2,(H,13,15);/q-1;+1 |
| InChIKey | CRVQWQWKNMHEKZ-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|