C13H20N2 — CID 58152695
N'-[(2,3,4,6-tetramethylphenyl)methyl]ethanimidamide (PubChem CID 58152695) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N'-[(2,3,4,6-tetramethylphenyl)methyl]ethanimidamide.
| Compound Name | N'-[(2,3,4,6-tetramethylphenyl)methyl]ethanimidamide |
|---|---|
| PubChem CID | 58152695 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N'-[(2,3,4,6-tetramethylphenyl)methyl]ethanimidamide |
| SMILES | C/C(N)=N\Cc1c(C)cc(C)c(C)c1C |
| InChI | InChI=1S/C13H20N2/c1-8-6-9(2)13(7-15-12(5)14)11(4)10(8)3/h6H,7H2,1-5H3,(H2,14,15) |
| InChIKey | DIUSMBUXKNWNKI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|