C12H24N2+2 — CID 58152801
1,4-dimethyl-1,4-bis(prop-2-enyl)piperazine-1,4-diium (PubChem CID 58152801) has the molecular formula C12H24N2+2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 1,4-dimethyl-1,4-bis(prop-2-enyl)piperazine-1,4-diium.
| Compound Name | 1,4-dimethyl-1,4-bis(prop-2-enyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 58152801 |
| Molecular Formula | C12H24N2+2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1,4-dimethyl-1,4-bis(prop-2-enyl)piperazine-1,4-diium |
| SMILES | C=CC[N+]1(C)CC[N+](C)(CC=C)CC1 |
| InChI | InChI=1S/C12H24N2/c1-5-7-13(3)9-11-14(4,8-6-2)12-10-13/h5-6H,1-2,7-12H2,3-4H3/q+2 |
| InChIKey | QAUXSFBAGPZCLI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|