About methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate
methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate (PubChem CID 58152808) has the molecular formula C8H16NO3+
and a molecular weight of 174.22 g/mol. Its IUPAC name is methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate |
| PubChem CID | 58152808 |
| Molecular Formula | C8H16NO3+ |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate |
| SMILES | COC(=O)CC[N+]1(C)CCOC1 |
| InChI | InChI=1S/C8H16NO3/c1-9(5-6-12-7-9)4-3-8(10)11-2/h3-7H2,1-2H3/q+1 |
| InChIKey | FFNAHXZGPUJYEY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate?
The IUPAC name of methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate (CID 58152808) is methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate.
What is the SMILES notation for methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate?
The canonical SMILES for methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate is COC(=O)CC[N+]1(C)CCOC1.
What is the InChIKey of methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate?
The InChIKey is FFNAHXZGPUJYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16NO3/c1-9(5-6-12-7-9)4-3-8(10)11-2/h3-7H2,1-2H3/q+1.
What are the key properties of methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate?
methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate has a molecular weight of 174.22 g/mol, XLogP of -0.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate is sourced from PubChem (CID 58152808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).