About 3-(difluoromethoxy)-2,5-dimethylthiophene
3-(difluoromethoxy)-2,5-dimethylthiophene (PubChem CID 58153014) has the molecular formula C7H8F2OS
and a molecular weight of 178.20 g/mol. Its IUPAC name is 3-(difluoromethoxy)-2,5-dimethylthiophene.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)-2,5-dimethylthiophene |
| PubChem CID | 58153014 |
| Molecular Formula | C7H8F2OS |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 3-(difluoromethoxy)-2,5-dimethylthiophene |
| SMILES | Cc1cc(OC(F)F)c(C)s1 |
| InChI | InChI=1S/C7H8F2OS/c1-4-3-6(5(2)11-4)10-7(8)9/h3,7H,1-2H3 |
| InChIKey | PPTTXSSGMJQTLV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(difluoromethoxy)-2,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)-2,5-dimethylthiophene?
The IUPAC name of 3-(difluoromethoxy)-2,5-dimethylthiophene (CID 58153014) is 3-(difluoromethoxy)-2,5-dimethylthiophene.
What is the SMILES notation for 3-(difluoromethoxy)-2,5-dimethylthiophene?
The canonical SMILES for 3-(difluoromethoxy)-2,5-dimethylthiophene is Cc1cc(OC(F)F)c(C)s1.
What is the InChIKey of 3-(difluoromethoxy)-2,5-dimethylthiophene?
The InChIKey is PPTTXSSGMJQTLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2OS/c1-4-3-6(5(2)11-4)10-7(8)9/h3,7H,1-2H3.
What are the key properties of 3-(difluoromethoxy)-2,5-dimethylthiophene?
3-(difluoromethoxy)-2,5-dimethylthiophene has a molecular weight of 178.20 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)-2,5-dimethylthiophene is sourced from PubChem (CID 58153014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).