About 3-ethoxy-2,5-dimethylthiophene
3-ethoxy-2,5-dimethylthiophene (PubChem CID 58153015) has the molecular formula C8H12OS
and a molecular weight of 156.25 g/mol. Its IUPAC name is 3-ethoxy-2,5-dimethylthiophene.
Molecular Properties
| Compound Name | 3-ethoxy-2,5-dimethylthiophene |
| PubChem CID | 58153015 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 3-ethoxy-2,5-dimethylthiophene |
| SMILES | CCOc1cc(C)sc1C |
| InChI | InChI=1S/C8H12OS/c1-4-9-8-5-6(2)10-7(8)3/h5H,4H2,1-3H3 |
| InChIKey | NCNIWJHOMNMJGU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-2,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2,5-dimethylthiophene?
The IUPAC name of 3-ethoxy-2,5-dimethylthiophene (CID 58153015) is 3-ethoxy-2,5-dimethylthiophene.
What is the SMILES notation for 3-ethoxy-2,5-dimethylthiophene?
The canonical SMILES for 3-ethoxy-2,5-dimethylthiophene is CCOc1cc(C)sc1C.
What is the InChIKey of 3-ethoxy-2,5-dimethylthiophene?
The InChIKey is NCNIWJHOMNMJGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OS/c1-4-9-8-5-6(2)10-7(8)3/h5H,4H2,1-3H3.
What are the key properties of 3-ethoxy-2,5-dimethylthiophene?
3-ethoxy-2,5-dimethylthiophene has a molecular weight of 156.25 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2,5-dimethylthiophene is sourced from PubChem (CID 58153015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).