About 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one
4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one (PubChem CID 58153119) has the molecular formula C17H24NO2+
and a molecular weight of 274.38 g/mol. Its IUPAC name is 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one.
Molecular Properties
| Compound Name | 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one |
| PubChem CID | 58153119 |
| Molecular Formula | C17H24NO2+ |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one |
| SMILES | CC(=O)CC[N+]1=C(C)C(C)(C)c2cc(CCO)ccc21 |
| InChI | InChI=1S/C17H24NO2/c1-12(20)7-9-18-13(2)17(3,4)15-11-14(8-10-19)5-6-16(15)18/h5-6,11,19H,7-10H2,1-4H3/q+1 |
| InChIKey | IURCXFIBASUCEQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one?
The IUPAC name of 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one (CID 58153119) is 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one.
What is the SMILES notation for 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one?
The canonical SMILES for 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one is CC(=O)CC[N+]1=C(C)C(C)(C)c2cc(CCO)ccc21.
What is the InChIKey of 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one?
The InChIKey is IURCXFIBASUCEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24NO2/c1-12(20)7-9-18-13(2)17(3,4)15-11-14(8-10-19)5-6-16(15)18/h5-6,11,19H,7-10H2,1-4H3/q+1.
What are the key properties of 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one?
4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one has a molecular weight of 274.38 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2-hydroxyethyl)-2,3,3-trimethylindol-1-ium-1-yl]butan-2-one is sourced from PubChem (CID 58153119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).