C17H26O7 — CID 58153190
[(1R,2R)-1-[(3aR,7aR)-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl]-1-acetyloxybutan-2-yl] acetate (PubChem CID 58153190) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(1R,2R)-1-[(3aR,7aR)-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl]-1-acetyloxybutan-2-yl] acetate.
| Compound Name | [(1R,2R)-1-[(3aR,7aR)-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl]-1-acetyloxybutan-2-yl] acetate |
|---|---|
| PubChem CID | 58153190 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(1R,2R)-1-[(3aR,7aR)-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl]-1-acetyloxybutan-2-yl] acetate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1OC(C)(C)C[C@H]2OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C17H26O7/c1-6-12(21-9(2)18)16(22-10(3)19)15-11-7-14(20)23-13(11)8-17(4,5)24-15/h11-13,15-16H,6-8H2,1-5H3/t11-,12-,13-,15?,16-/m1/s1 |
| InChIKey | FKPMVLLEMMITKW-JUJCDVQUSA-N |
| XLogP | 1.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|