C25H40O10 — CID 58153199
methyl (3aR,6R,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-6-[[(3R,4R,6S)-3-hydroxy-4,5,6-trimethyloxan-2-yl]methoxy]-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate (PubChem CID 58153199) has the molecular formula C25H40O10 and a molecular weight of 500.59 g/mol. Its IUPAC name is methyl (3aR,6R,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-6-[[(3R,4R,6S)-3-hydroxy-4,5,6-trimethyloxan-2-yl]methoxy]-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate.
| Compound Name | methyl (3aR,6R,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-6-[[(3R,4R,6S)-3-hydroxy-4,5,6-trimethyloxan-2-yl]methoxy]-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
|---|---|
| PubChem CID | 58153199 |
| Molecular Formula | C25H40O10 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | methyl (3aR,6R,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-6-[[(3R,4R,6S)-3-hydroxy-4,5,6-trimethyloxan-2-yl]methoxy]-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
| SMILES | CC[C@@H](C)[C@@H](OC(C)=O)C1O[C@@](OCC2O[C@@H](C)C(C)C(C)[C@H]2O)(C(=O)OC)C[C@H]2OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C25H40O10/c1-8-12(2)22(33-16(6)26)23-17-9-20(27)34-18(17)10-25(35-23,24(29)30-7)31-11-19-21(28)14(4)13(3)15(5)32-19/h12-15,17-19,21-23,28H,8-11H2,1-7H3/t12-,13?,14?,15+,17-,18-,19?,21-,22-,23?,25-/m1/s1 |
| InChIKey | RVBVRMYYMNGPSU-ZZHCNKOLSA-N |
| XLogP | 1.99 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|