C25H41O13P — CID 58153200
methyl (3aR,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-dibutoxyphosphoryloxy-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate (PubChem CID 58153200) has the molecular formula C25H41O13P and a molecular weight of 580.56 g/mol. Its IUPAC name is methyl (3aR,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-dibutoxyphosphoryloxy-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate.
| Compound Name | methyl (3aR,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-dibutoxyphosphoryloxy-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
|---|---|
| PubChem CID | 58153200 |
| Molecular Formula | C25H41O13P |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | methyl (3aR,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-dibutoxyphosphoryloxy-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
| SMILES | CCCCOP(=O)(OCCCC)OC1(C(=O)OC)C[C@H]2OC(=O)C[C@H]2C([C@H](OC(C)=O)[C@@H](CC)OC(C)=O)O1 |
| InChI | InChI=1S/C25H41O13P/c1-7-10-12-32-39(30,33-13-11-8-2)38-25(24(29)31-6)15-20-18(14-21(28)36-20)22(37-25)23(35-17(5)27)19(9-3)34-16(4)26/h18-20,22-23H,7-15H2,1-6H3/t18-,19-,20-,22?,23-,25?/m1/s1 |
| InChIKey | NBLQQFDZRBVADO-MORBIXCMSA-N |
| XLogP | 3.61 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|