C11H20O4 — CID 58153213
(3R,4R,6R)-2-(hydroxymethyl)-4,5-dimethyl-6-prop-2-enoxyoxan-3-ol (PubChem CID 58153213) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is (3R,4R,6R)-2-(hydroxymethyl)-4,5-dimethyl-6-prop-2-enoxyoxan-3-ol.
| Compound Name | (3R,4R,6R)-2-(hydroxymethyl)-4,5-dimethyl-6-prop-2-enoxyoxan-3-ol |
|---|---|
| PubChem CID | 58153213 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (3R,4R,6R)-2-(hydroxymethyl)-4,5-dimethyl-6-prop-2-enoxyoxan-3-ol |
| SMILES | C=CCO[C@@H]1OC(CO)[C@H](O)[C@H](C)C1C |
| InChI | InChI=1S/C11H20O4/c1-4-5-14-11-8(3)7(2)10(13)9(6-12)15-11/h4,7-13H,1,5-6H2,2-3H3/t7-,8?,9?,10-,11-/m1/s1 |
| InChIKey | SWLQLYYLQYAAPN-LRPJUKONSA-N |
| XLogP | 0.54 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|