C18H26O9 — CID 58153216
methyl (3aR,6R,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-methyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate (PubChem CID 58153216) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is methyl (3aR,6R,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-methyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate.
| Compound Name | methyl (3aR,6R,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-methyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
|---|---|
| PubChem CID | 58153216 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | methyl (3aR,6R,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-methyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1O[C@@](C)(C(=O)OC)C[C@H]2OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C18H26O9/c1-6-12(24-9(2)19)16(25-10(3)20)15-11-7-14(21)26-13(11)8-18(4,27-15)17(22)23-5/h11-13,15-16H,6-8H2,1-5H3/t11-,12-,13-,15?,16-,18-/m1/s1 |
| InChIKey | CTGQQPQAAHUESW-KJDUGBSISA-N |
| XLogP | 0.91 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|