C26H42O9 — CID 58153217
methyl (3aR,6R,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-2-oxo-6-[[(3R,4R,6S)-3,4,5,6-tetramethyloxan-2-yl]methoxy]-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate (PubChem CID 58153217) has the molecular formula C26H42O9 and a molecular weight of 498.61 g/mol. Its IUPAC name is methyl (3aR,6R,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-2-oxo-6-[[(3R,4R,6S)-3,4,5,6-tetramethyloxan-2-yl]methoxy]-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate.
| Compound Name | methyl (3aR,6R,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-2-oxo-6-[[(3R,4R,6S)-3,4,5,6-tetramethyloxan-2-yl]methoxy]-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
|---|---|
| PubChem CID | 58153217 |
| Molecular Formula | C26H42O9 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | methyl (3aR,6R,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-2-oxo-6-[[(3R,4R,6S)-3,4,5,6-tetramethyloxan-2-yl]methoxy]-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
| SMILES | CC[C@@H](C)[C@@H](OC(C)=O)C1O[C@@](OCC2O[C@@H](C)C(C)C(C)[C@H]2C)(C(=O)OC)C[C@H]2OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C26H42O9/c1-9-13(2)23(33-18(7)27)24-19-10-22(28)34-20(19)11-26(35-24,25(29)30-8)31-12-21-16(5)14(3)15(4)17(6)32-21/h13-17,19-21,23-24H,9-12H2,1-8H3/t13-,14?,15?,16-,17+,19-,20-,21?,23-,24?,26-/m1/s1 |
| InChIKey | JHJNZFZTATYIBN-LKCNOUGPSA-N |
| XLogP | 3.27 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|