C17H24NO9Y- — CID 58153220
methyl (3aR,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-3-methyl-2-oxo-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazol-6-ide-6-carboxylate;yttrium (PubChem CID 58153220) has the molecular formula C17H24NO9Y- and a molecular weight of 475.28 g/mol. Its IUPAC name is methyl (3aR,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-3-methyl-2-oxo-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazol-6-ide-6-carboxylate;yttrium.
| Compound Name | methyl (3aR,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-3-methyl-2-oxo-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazol-6-ide-6-carboxylate;yttrium |
|---|---|
| PubChem CID | 58153220 |
| Molecular Formula | C17H24NO9Y- |
| Molecular Weight | 475.28 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | methyl (3aR,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-3-methyl-2-oxo-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazol-6-ide-6-carboxylate;yttrium |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1O[C-](C(=O)OC)C[C@H]2OC(=O)N(C)[C@@H]12.[Y] |
| InChI | InChI=1S/C17H24NO9.Y/c1-6-10(24-8(2)19)14(25-9(3)20)15-13-11(27-17(22)18(13)4)7-12(26-15)16(21)23-5;/h10-11,13-15H,6-7H2,1-5H3;/q-1;/t10-,11-,13-,14-,15?;/m1./s1 |
| InChIKey | RNJGKHKJVNAXDJ-ABONDCAASA-N |
| XLogP | 0.57 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|