About ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate
ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 58153300) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| PubChem CID | 58153300 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N(CC1=CC=CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO4/c1-6-20-14(18)12(2)17(11-13-9-7-8-10-13)15(19)21-16(3,4)5/h7-9,12H,6,10-11H2,1-5H3/t12-/m0/s1 |
| InChIKey | BGZVCHOGEJTBJT-LBPRGKRZSA-N |
| XLogP | 3.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate?
The IUPAC name of ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (CID 58153300) is ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
What is the SMILES notation for ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate?
The canonical SMILES for ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate is CCOC(=O)[C@H](C)N(CC1=CC=CC1)C(=O)OC(C)(C)C.
What is the InChIKey of ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate?
The InChIKey is BGZVCHOGEJTBJT-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H25NO4/c1-6-20-14(18)12(2)17(11-13-9-7-8-10-13)15(19)21-16(3,4)5/h7-9,12H,6,10-11H2,1-5H3/t12-/m0/s1.
What are the key properties of ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate?
ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate has a molecular weight of 295.38 g/mol, XLogP of 3.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-[cyclopenta-1,3-dien-1-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate is sourced from PubChem (CID 58153300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).