About 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine
6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine (PubChem CID 58153470) has the molecular formula C17H20Cl2N2O
and a molecular weight of 339.27 g/mol. Its IUPAC name is 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine.
Molecular Properties
| Compound Name | 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine |
| PubChem CID | 58153470 |
| Molecular Formula | C17H20Cl2N2O |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine |
| SMILES | CC(C)c1cc(Oc2ccc(Cl)c(Cl)c2)nc(C(C)C)c1N |
| InChI | InChI=1S/C17H20Cl2N2O/c1-9(2)12-8-15(21-17(10(3)4)16(12)20)22-11-5-6-13(18)14(19)7-11/h5-10H,20H2,1-4H3 |
| InChIKey | ZVRKGGORPJWLQT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine?
The IUPAC name of 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine (CID 58153470) is 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine.
What is the SMILES notation for 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine?
The canonical SMILES for 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine is CC(C)c1cc(Oc2ccc(Cl)c(Cl)c2)nc(C(C)C)c1N.
What is the InChIKey of 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine?
The InChIKey is ZVRKGGORPJWLQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20Cl2N2O/c1-9(2)12-8-15(21-17(10(3)4)16(12)20)22-11-5-6-13(18)14(19)7-11/h5-10H,20H2,1-4H3.
What are the key properties of 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine?
6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine has a molecular weight of 339.27 g/mol, XLogP of 6.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dichlorophenoxy)-2,4-di(propan-2-yl)pyridin-3-amine is sourced from PubChem (CID 58153470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).