C17H18N6O2 — CID 58153897
16-methyl-2,8,12,16,19,20-hexazatetracyclo[10.7.2.13,7.017,21]docosa-1(19),3(22),4,6,17,20-hexaene-9,15-dione (PubChem CID 58153897) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 16-methyl-2,8,12,16,19,20-hexazatetracyclo[10.7.2.13,7.017,21]docosa-1(19),3(22),4,6,17,20-hexaene-9,15-dione.
| Compound Name | 16-methyl-2,8,12,16,19,20-hexazatetracyclo[10.7.2.13,7.017,21]docosa-1(19),3(22),4,6,17,20-hexaene-9,15-dione |
|---|---|
| PubChem CID | 58153897 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 16-methyl-2,8,12,16,19,20-hexazatetracyclo[10.7.2.13,7.017,21]docosa-1(19),3(22),4,6,17,20-hexaene-9,15-dione |
| SMILES | CN1C(=O)CCN2CCC(=O)Nc3cccc(c3)Nc3ncc1c2n3 |
| InChI | InChI=1S/C17H18N6O2/c1-22-13-10-18-17-20-12-4-2-3-11(9-12)19-14(24)5-7-23(16(13)21-17)8-6-15(22)25/h2-4,9-10H,5-8H2,1H3,(H,19,24)(H,18,20,21) |
| InChIKey | KRCJBHGRIATJPP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |