C33H47N7O3 — CID 58153902
4-[(9-cyclopentyl-5-methyl-6-oxospiro[8H-pyrimido[4,5-b][1,4]diazepine-7,1'-cyclopropane]-2-yl)amino]-3-methoxy-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)benzamide (PubChem CID 58153902) has the molecular formula C33H47N7O3 and a molecular weight of 589.79 g/mol. Its IUPAC name is 4-[(9-cyclopentyl-5-methyl-6-oxospiro[8H-pyrimido[4,5-b][1,4]diazepine-7,1'-cyclopropane]-2-yl)amino]-3-methoxy-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)benzamide.
| Compound Name | 4-[(9-cyclopentyl-5-methyl-6-oxospiro[8H-pyrimido[4,5-b][1,4]diazepine-7,1'-cyclopropane]-2-yl)amino]-3-methoxy-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 58153902 |
| Molecular Formula | C33H47N7O3 |
| Molecular Weight | 589.79 g/mol |
| Exact Mass | 589.37 |
| IUPAC Name | 4-[(9-cyclopentyl-5-methyl-6-oxospiro[8H-pyrimido[4,5-b][1,4]diazepine-7,1'-cyclopropane]-2-yl)amino]-3-methoxy-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)benzamide |
| SMILES | COc1cc(C(=O)NC2CC(C)(C)N(C)C(C)(C)C2)ccc1Nc1ncc2c(n1)N(C1CCCC1)CC1(CC1)C(=O)N2C |
| InChI | InChI=1S/C33H47N7O3/c1-31(2)17-22(18-32(3,4)39(31)6)35-28(41)21-12-13-24(26(16-21)43-7)36-30-34-19-25-27(37-30)40(23-10-8-9-11-23)20-33(14-15-33)29(42)38(25)5/h12-13,16,19,22-23H,8-11,14-15,17-18,20H2,1-7H3,(H,35,41)(H,34,36,37) |
| InChIKey | DAUCRMZUYFYOIJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |