C17H23BO3 — CID 58154274
3,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-inden-2-one (PubChem CID 58154274) has the molecular formula C17H23BO3 and a molecular weight of 286.18 g/mol. Its IUPAC name is 3,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-inden-2-one.
| Compound Name | 3,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-inden-2-one |
|---|---|
| PubChem CID | 58154274 |
| Molecular Formula | C17H23BO3 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-inden-2-one |
| SMILES | CC1(C)C(=O)Cc2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C17H23BO3/c1-15(2)13-8-7-12(9-11(13)10-14(15)19)18-20-16(3,4)17(5,6)21-18/h7-9H,10H2,1-6H3 |
| InChIKey | QCJAAQSQPORRDE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|